C17H21F3N2O5 — CID 119189897
3-[[5-(dimethylamino)-5-oxopentanoyl]amino]-3-[4-(trifluoromethoxy)phenyl]propanoic acid (PubChem CID 119189897) has the molecular formula C17H21F3N2O5 and a molecular weight of 390.36 g/mol. Its IUPAC name is 3-[[5-(dimethylamino)-5-oxopentanoyl]amino]-3-[4-(trifluoromethoxy)phenyl]propanoic acid.
| Compound Name | 3-[[5-(dimethylamino)-5-oxopentanoyl]amino]-3-[4-(trifluoromethoxy)phenyl]propanoic acid |
|---|---|
| PubChem CID | 119189897 |
| Molecular Formula | C17H21F3N2O5 |
| Molecular Weight | 390.36 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | 3-[[5-(dimethylamino)-5-oxopentanoyl]amino]-3-[4-(trifluoromethoxy)phenyl]propanoic acid |
| SMILES | CN(C)C(=O)CCCC(=O)NC(CC(=O)O)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C17H21F3N2O5/c1-22(2)15(24)5-3-4-14(23)21-13(10-16(25)26)11-6-8-12(9-7-11)27-17(18,19)20/h6-9,13H,3-5,10H2,1-2H3,(H,21,23)(H,25,26) |
| InChIKey | ZXBHLNFBDXWMBO-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.36 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |