C16H16F3NO4 — CID 119189903
3-(cyclopent-3-ene-1-carbonylamino)-3-[4-(trifluoromethoxy)phenyl]propanoic acid (PubChem CID 119189903) has the molecular formula C16H16F3NO4 and a molecular weight of 343.30 g/mol. Its IUPAC name is 3-(cyclopent-3-ene-1-carbonylamino)-3-[4-(trifluoromethoxy)phenyl]propanoic acid.
| Compound Name | 3-(cyclopent-3-ene-1-carbonylamino)-3-[4-(trifluoromethoxy)phenyl]propanoic acid |
|---|---|
| PubChem CID | 119189903 |
| Molecular Formula | C16H16F3NO4 |
| Molecular Weight | 343.30 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | 3-(cyclopent-3-ene-1-carbonylamino)-3-[4-(trifluoromethoxy)phenyl]propanoic acid |
| SMILES | O=C(O)CC(NC(=O)C1CC=CC1)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C16H16F3NO4/c17-16(18,19)24-12-7-5-10(6-8-12)13(9-14(21)22)20-15(23)11-3-1-2-4-11/h1-2,5-8,11,13H,3-4,9H2,(H,20,23)(H,21,22) |
| InChIKey | DUDMKWABONTNFJ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.30 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|