C16H18F3NO4S — CID 120516296
3-(thiane-4-carbonylamino)-3-[4-(trifluoromethoxy)phenyl]propanoic acid (PubChem CID 120516296) has the molecular formula C16H18F3NO4S and a molecular weight of 377.38 g/mol. Its IUPAC name is 3-(thiane-4-carbonylamino)-3-[4-(trifluoromethoxy)phenyl]propanoic acid.
| Compound Name | 3-(thiane-4-carbonylamino)-3-[4-(trifluoromethoxy)phenyl]propanoic acid |
|---|---|
| PubChem CID | 120516296 |
| Molecular Formula | C16H18F3NO4S |
| Molecular Weight | 377.38 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | 3-(thiane-4-carbonylamino)-3-[4-(trifluoromethoxy)phenyl]propanoic acid |
| SMILES | O=C(O)CC(NC(=O)C1CCSCC1)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C16H18F3NO4S/c17-16(18,19)24-12-3-1-10(2-4-12)13(9-14(21)22)20-15(23)11-5-7-25-8-6-11/h1-4,11,13H,5-9H2,(H,20,23)(H,21,22) |
| InChIKey | UHWVOXQVRLYQHE-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.38 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |