C17H16F3NO4S — CID 119189880
3-[[2-(5-methylthiophen-2-yl)acetyl]amino]-3-[4-(trifluoromethoxy)phenyl]propanoic acid (PubChem CID 119189880) has the molecular formula C17H16F3NO4S and a molecular weight of 387.38 g/mol. Its IUPAC name is 3-[[2-(5-methylthiophen-2-yl)acetyl]amino]-3-[4-(trifluoromethoxy)phenyl]propanoic acid.
| Compound Name | 3-[[2-(5-methylthiophen-2-yl)acetyl]amino]-3-[4-(trifluoromethoxy)phenyl]propanoic acid |
|---|---|
| PubChem CID | 119189880 |
| Molecular Formula | C17H16F3NO4S |
| Molecular Weight | 387.38 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | 3-[[2-(5-methylthiophen-2-yl)acetyl]amino]-3-[4-(trifluoromethoxy)phenyl]propanoic acid |
| SMILES | Cc1ccc(CC(=O)NC(CC(=O)O)c2ccc(OC(F)(F)F)cc2)s1 |
| InChI | InChI=1S/C17H16F3NO4S/c1-10-2-7-13(26-10)8-15(22)21-14(9-16(23)24)11-3-5-12(6-4-11)25-17(18,19)20/h2-7,14H,8-9H2,1H3,(H,21,22)(H,23,24) |
| InChIKey | NWNKQYNUFLHFNW-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.38 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |