C13H15F2NO3 — CID 82349465
4-(3,4-difluorophenyl)-4-hydroxy-3-(prop-2-enylamino)butanoic acid (PubChem CID 82349465) has the molecular formula C13H15F2NO3 and a molecular weight of 271.26 g/mol. Its IUPAC name is 4-(3,4-difluorophenyl)-4-hydroxy-3-(prop-2-enylamino)butanoic acid.
| Compound Name | 4-(3,4-difluorophenyl)-4-hydroxy-3-(prop-2-enylamino)butanoic acid |
|---|---|
| PubChem CID | 82349465 |
| Molecular Formula | C13H15F2NO3 |
| Molecular Weight | 271.26 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | 4-(3,4-difluorophenyl)-4-hydroxy-3-(prop-2-enylamino)butanoic acid |
| SMILES | C=CCNC(CC(=O)O)C(O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C13H15F2NO3/c1-2-5-16-11(7-12(17)18)13(19)8-3-4-9(14)10(15)6-8/h2-4,6,11,13,16,19H,1,5,7H2,(H,17,18) |
| InChIKey | GANFUAOQTKQTTK-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.26 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|