C16H25NO3 — CID 82347592
3-(butylamino)-4-(3,4-dimethylphenyl)-4-hydroxybutanoic acid (PubChem CID 82347592) has the molecular formula C16H25NO3 and a molecular weight of 279.38 g/mol. Its IUPAC name is 3-(butylamino)-4-(3,4-dimethylphenyl)-4-hydroxybutanoic acid.
| Compound Name | 3-(butylamino)-4-(3,4-dimethylphenyl)-4-hydroxybutanoic acid |
|---|---|
| PubChem CID | 82347592 |
| Molecular Formula | C16H25NO3 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.18 |
| IUPAC Name | 3-(butylamino)-4-(3,4-dimethylphenyl)-4-hydroxybutanoic acid |
| SMILES | CCCCNC(CC(=O)O)C(O)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C16H25NO3/c1-4-5-8-17-14(10-15(18)19)16(20)13-7-6-11(2)12(3)9-13/h6-7,9,14,16-17,20H,4-5,8,10H2,1-3H3,(H,18,19) |
| InChIKey | SPARGKRGAQRNOR-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|