C17H27NO3 — CID 82349613
methyl 3-(butylamino)-4-(2,5-dimethylphenyl)-4-hydroxybutanoate (PubChem CID 82349613) has the molecular formula C17H27NO3 and a molecular weight of 293.41 g/mol. Its IUPAC name is methyl 3-(butylamino)-4-(2,5-dimethylphenyl)-4-hydroxybutanoate.
| Compound Name | methyl 3-(butylamino)-4-(2,5-dimethylphenyl)-4-hydroxybutanoate |
|---|---|
| PubChem CID | 82349613 |
| Molecular Formula | C17H27NO3 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.20 |
| IUPAC Name | methyl 3-(butylamino)-4-(2,5-dimethylphenyl)-4-hydroxybutanoate |
| SMILES | CCCCNC(CC(=O)OC)C(O)c1cc(C)ccc1C |
| InChI | InChI=1S/C17H27NO3/c1-5-6-9-18-15(11-16(19)21-4)17(20)14-10-12(2)7-8-13(14)3/h7-8,10,15,17-18,20H,5-6,9,11H2,1-4H3 |
| InChIKey | HCATUMUTTWTDMS-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|