C15H19NO5 — CID 82348783
5-(1,3-benzodioxol-5-yl)-5-hydroxy-4-(prop-2-enylamino)pentanoic acid (PubChem CID 82348783) has the molecular formula C15H19NO5 and a molecular weight of 293.32 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-yl)-5-hydroxy-4-(prop-2-enylamino)pentanoic acid.
| Compound Name | 5-(1,3-benzodioxol-5-yl)-5-hydroxy-4-(prop-2-enylamino)pentanoic acid |
|---|---|
| PubChem CID | 82348783 |
| Molecular Formula | C15H19NO5 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | 5-(1,3-benzodioxol-5-yl)-5-hydroxy-4-(prop-2-enylamino)pentanoic acid |
| SMILES | C=CCNC(CCC(=O)O)C(O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H19NO5/c1-2-7-16-11(4-6-14(17)18)15(19)10-3-5-12-13(8-10)21-9-20-12/h2-3,5,8,11,15-16,19H,1,4,6-7,9H2,(H,17,18) |
| InChIKey | AJNIYWQZRATAIA-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|