C15H21NO5 — CID 82348766
4-(1,3-benzodioxol-5-yl)-3-(butylamino)-4-hydroxybutanoic acid (PubChem CID 82348766) has the molecular formula C15H21NO5 and a molecular weight of 295.33 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-yl)-3-(butylamino)-4-hydroxybutanoic acid.
| Compound Name | 4-(1,3-benzodioxol-5-yl)-3-(butylamino)-4-hydroxybutanoic acid |
|---|---|
| PubChem CID | 82348766 |
| Molecular Formula | C15H21NO5 |
| Molecular Weight | 295.33 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | 4-(1,3-benzodioxol-5-yl)-3-(butylamino)-4-hydroxybutanoic acid |
| SMILES | CCCCNC(CC(=O)O)C(O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H21NO5/c1-2-3-6-16-11(8-14(17)18)15(19)10-4-5-12-13(7-10)21-9-20-12/h4-5,7,11,15-16,19H,2-3,6,8-9H2,1H3,(H,17,18) |
| InChIKey | IGSNIFZSBPXKDB-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.33 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|