C12H13ClN2O4 — CID 82214972
2-[[2-chloro-2-(2-oxo-3H-1,3-benzoxazol-6-yl)ethyl]-methylamino]acetic acid (PubChem CID 82214972) has the molecular formula C12H13ClN2O4 and a molecular weight of 284.70 g/mol. Its IUPAC name is 2-[[2-chloro-2-(2-oxo-3H-1,3-benzoxazol-6-yl)ethyl]-methylamino]acetic acid.
| Compound Name | 2-[[2-chloro-2-(2-oxo-3H-1,3-benzoxazol-6-yl)ethyl]-methylamino]acetic acid |
|---|---|
| PubChem CID | 82214972 |
| Molecular Formula | C12H13ClN2O4 |
| Molecular Weight | 284.70 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | 2-[[2-chloro-2-(2-oxo-3H-1,3-benzoxazol-6-yl)ethyl]-methylamino]acetic acid |
| SMILES | CN(CC(=O)O)CC(Cl)c1ccc2[nH]c(=O)oc2c1 |
| InChI | InChI=1S/C12H13ClN2O4/c1-15(6-11(16)17)5-8(13)7-2-3-9-10(4-7)19-12(18)14-9/h2-4,8H,5-6H2,1H3,(H,14,18)(H,16,17) |
| InChIKey | YKWOZAHSGCRJDH-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 86.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.70 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|