C14H19ClN2O2 — CID 82214976
6-[2-[butyl(methyl)amino]-1-chloroethyl]-3H-1,3-benzoxazol-2-one (PubChem CID 82214976) has the molecular formula C14H19ClN2O2 and a molecular weight of 282.77 g/mol. Its IUPAC name is 6-[2-[butyl(methyl)amino]-1-chloroethyl]-3H-1,3-benzoxazol-2-one.
| Compound Name | 6-[2-[butyl(methyl)amino]-1-chloroethyl]-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 82214976 |
| Molecular Formula | C14H19ClN2O2 |
| Molecular Weight | 282.77 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | 6-[2-[butyl(methyl)amino]-1-chloroethyl]-3H-1,3-benzoxazol-2-one |
| SMILES | CCCCN(C)CC(Cl)c1ccc2[nH]c(=O)oc2c1 |
| InChI | InChI=1S/C14H19ClN2O2/c1-3-4-7-17(2)9-11(15)10-5-6-12-13(8-10)19-14(18)16-12/h5-6,8,11H,3-4,7,9H2,1-2H3,(H,16,18) |
| InChIKey | HLNXLEZJNAJABZ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 49.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.77 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|