C15H24ClNO2 — CID 82214957
N-[2-chloro-2-(3,4-dimethoxyphenyl)ethyl]-N-methylbutan-1-amine (PubChem CID 82214957) has the molecular formula C15H24ClNO2 and a molecular weight of 285.82 g/mol. Its IUPAC name is N-[2-chloro-2-(3,4-dimethoxyphenyl)ethyl]-N-methylbutan-1-amine.
| Compound Name | N-[2-chloro-2-(3,4-dimethoxyphenyl)ethyl]-N-methylbutan-1-amine |
|---|---|
| PubChem CID | 82214957 |
| Molecular Formula | C15H24ClNO2 |
| Molecular Weight | 285.82 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | N-[2-chloro-2-(3,4-dimethoxyphenyl)ethyl]-N-methylbutan-1-amine |
| SMILES | CCCCN(C)CC(Cl)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C15H24ClNO2/c1-5-6-9-17(2)11-13(16)12-7-8-14(18-3)15(10-12)19-4/h7-8,10,13H,5-6,9,11H2,1-4H3 |
| InChIKey | MVOHAPBFTNEQAU-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.82 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|