C16H26ClNO — CID 82214749
N-[2-chloro-2-(4-methoxy-3-methylphenyl)ethyl]-N-propylpropan-1-amine (PubChem CID 82214749) has the molecular formula C16H26ClNO and a molecular weight of 283.84 g/mol. Its IUPAC name is N-[2-chloro-2-(4-methoxy-3-methylphenyl)ethyl]-N-propylpropan-1-amine.
| Compound Name | N-[2-chloro-2-(4-methoxy-3-methylphenyl)ethyl]-N-propylpropan-1-amine |
|---|---|
| PubChem CID | 82214749 |
| Molecular Formula | C16H26ClNO |
| Molecular Weight | 283.84 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | N-[2-chloro-2-(4-methoxy-3-methylphenyl)ethyl]-N-propylpropan-1-amine |
| SMILES | CCCN(CCC)CC(Cl)c1ccc(OC)c(C)c1 |
| InChI | InChI=1S/C16H26ClNO/c1-5-9-18(10-6-2)12-15(17)14-7-8-16(19-4)13(3)11-14/h7-8,11,15H,5-6,9-10,12H2,1-4H3 |
| InChIKey | XOSUSCPLERSYCO-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.84 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|