C16H26ClNO2 — CID 82214944
N-[2-chloro-2-(3,4-dimethoxyphenyl)ethyl]-N-propylpropan-1-amine (PubChem CID 82214944) has the molecular formula C16H26ClNO2 and a molecular weight of 299.84 g/mol. Its IUPAC name is N-[2-chloro-2-(3,4-dimethoxyphenyl)ethyl]-N-propylpropan-1-amine.
| Compound Name | N-[2-chloro-2-(3,4-dimethoxyphenyl)ethyl]-N-propylpropan-1-amine |
|---|---|
| PubChem CID | 82214944 |
| Molecular Formula | C16H26ClNO2 |
| Molecular Weight | 299.84 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | N-[2-chloro-2-(3,4-dimethoxyphenyl)ethyl]-N-propylpropan-1-amine |
| SMILES | CCCN(CCC)CC(Cl)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C16H26ClNO2/c1-5-9-18(10-6-2)12-14(17)13-7-8-15(19-3)16(11-13)20-4/h7-8,11,14H,5-6,9-10,12H2,1-4H3 |
| InChIKey | VDHIOCZFTRKYNL-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.84 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|