C11H14N2O4 — CID 115122051
6-[2,3-dihydroxypropyl(methyl)amino]-3H-1,3-benzoxazol-2-one (PubChem CID 115122051) has the molecular formula C11H14N2O4 and a molecular weight of 238.24 g/mol. Its IUPAC name is 6-[2,3-dihydroxypropyl(methyl)amino]-3H-1,3-benzoxazol-2-one.
| Compound Name | 6-[2,3-dihydroxypropyl(methyl)amino]-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 115122051 |
| Molecular Formula | C11H14N2O4 |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | 6-[2,3-dihydroxypropyl(methyl)amino]-3H-1,3-benzoxazol-2-one |
| SMILES | CN(CC(O)CO)c1ccc2[nH]c(=O)oc2c1 |
| InChI | InChI=1S/C11H14N2O4/c1-13(5-8(15)6-14)7-2-3-9-10(4-7)17-11(16)12-9/h2-4,8,14-15H,5-6H2,1H3,(H,12,16) |
| InChIKey | SRBYJQIYVGSNND-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |