C11H15N3O2 — CID 115196445
5-[2-aminopropyl(methyl)amino]-3H-1,3-benzoxazol-2-one (PubChem CID 115196445) has the molecular formula C11H15N3O2 and a molecular weight of 221.26 g/mol. Its IUPAC name is 5-[2-aminopropyl(methyl)amino]-3H-1,3-benzoxazol-2-one.
| Compound Name | 5-[2-aminopropyl(methyl)amino]-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 115196445 |
| Molecular Formula | C11H15N3O2 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | 5-[2-aminopropyl(methyl)amino]-3H-1,3-benzoxazol-2-one |
| SMILES | CC(N)CN(C)c1ccc2oc(=O)[nH]c2c1 |
| InChI | InChI=1S/C11H15N3O2/c1-7(12)6-14(2)8-3-4-10-9(5-8)13-11(15)16-10/h3-5,7H,6,12H2,1-2H3,(H,13,15) |
| InChIKey | GMLAONMHERTHTK-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 75.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |