C9H7N3O2 — CID 117043254
methyl-(2-oxo-3H-1,3-benzoxazol-5-yl)cyanamide (PubChem CID 117043254) has the molecular formula C9H7N3O2 and a molecular weight of 189.17 g/mol. Its IUPAC name is methyl-(2-oxo-3H-1,3-benzoxazol-5-yl)cyanamide.
| Compound Name | methyl-(2-oxo-3H-1,3-benzoxazol-5-yl)cyanamide |
|---|---|
| PubChem CID | 117043254 |
| Molecular Formula | C9H7N3O2 |
| Molecular Weight | 189.17 g/mol |
| Exact Mass | 189.05 |
| IUPAC Name | methyl-(2-oxo-3H-1,3-benzoxazol-5-yl)cyanamide |
| SMILES | CN(C#N)c1ccc2oc(=O)[nH]c2c1 |
| InChI | InChI=1S/C9H7N3O2/c1-12(5-10)6-2-3-8-7(4-6)11-9(13)14-8/h2-4H,1H3,(H,11,13) |
| InChIKey | ASMAFLVJVVXCLD-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 73.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.17 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|