C13H15ClN2O4S — CID 43502850
6-chloro-5-(4-hydroxypiperidin-1-yl)sulfonyl-1,3-dihydroindol-2-one (PubChem CID 43502850) has the molecular formula C13H15ClN2O4S and a molecular weight of 330.79 g/mol. Its IUPAC name is 6-chloro-5-(4-hydroxypiperidin-1-yl)sulfonyl-1,3-dihydroindol-2-one.
| Compound Name | 6-chloro-5-(4-hydroxypiperidin-1-yl)sulfonyl-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 43502850 |
| Molecular Formula | C13H15ClN2O4S |
| Molecular Weight | 330.79 g/mol |
| Exact Mass | 330.04 |
| IUPAC Name | 6-chloro-5-(4-hydroxypiperidin-1-yl)sulfonyl-1,3-dihydroindol-2-one |
| SMILES | O=C1Cc2cc(S(=O)(=O)N3CCC(O)CC3)c(Cl)cc2N1 |
| InChI | InChI=1S/C13H15ClN2O4S/c14-10-7-11-8(6-13(18)15-11)5-12(10)21(19,20)16-3-1-9(17)2-4-16/h5,7,9,17H,1-4,6H2,(H,15,18) |
| InChIKey | VJQPLOCBRCQHFW-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.79 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |