C16H18BrClN2O3S2 — CID 43064529
5-bromo-N-[2-(2-chlorophenyl)-2-morpholin-4-ylethyl]thiophene-2-sulfonamide (PubChem CID 43064529) has the molecular formula C16H18BrClN2O3S2 and a molecular weight of 465.82 g/mol. Its IUPAC name is 5-bromo-N-[2-(2-chlorophenyl)-2-morpholin-4-ylethyl]thiophene-2-sulfonamide.
| Compound Name | 5-bromo-N-[2-(2-chlorophenyl)-2-morpholin-4-ylethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 43064529 |
| Molecular Formula | C16H18BrClN2O3S2 |
| Molecular Weight | 465.82 g/mol |
| Exact Mass | 463.96 |
| IUPAC Name | 5-bromo-N-[2-(2-chlorophenyl)-2-morpholin-4-ylethyl]thiophene-2-sulfonamide |
| SMILES | O=S(=O)(NCC(c1ccccc1Cl)N1CCOCC1)c1ccc(Br)s1 |
| InChI | InChI=1S/C16H18BrClN2O3S2/c17-15-5-6-16(24-15)25(21,22)19-11-14(20-7-9-23-10-8-20)12-3-1-2-4-13(12)18/h1-6,14,19H,7-11H2 |
| InChIKey | VTSMHENZGPELEJ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.82 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |