C19H23BrClN3O2S — CID 112820227
1-[2-(5-bromothiophen-2-yl)ethyl]-3-[2-(2-chlorophenyl)-2-morpholin-4-ylethyl]urea (PubChem CID 112820227) has the molecular formula C19H23BrClN3O2S and a molecular weight of 472.84 g/mol. Its IUPAC name is 1-[2-(5-bromothiophen-2-yl)ethyl]-3-[2-(2-chlorophenyl)-2-morpholin-4-ylethyl]urea.
| Compound Name | 1-[2-(5-bromothiophen-2-yl)ethyl]-3-[2-(2-chlorophenyl)-2-morpholin-4-ylethyl]urea |
|---|---|
| PubChem CID | 112820227 |
| Molecular Formula | C19H23BrClN3O2S |
| Molecular Weight | 472.84 g/mol |
| Exact Mass | 471.04 |
| IUPAC Name | 1-[2-(5-bromothiophen-2-yl)ethyl]-3-[2-(2-chlorophenyl)-2-morpholin-4-ylethyl]urea |
| SMILES | O=C(NCCc1ccc(Br)s1)NCC(c1ccccc1Cl)N1CCOCC1 |
| InChI | InChI=1S/C19H23BrClN3O2S/c20-18-6-5-14(27-18)7-8-22-19(25)23-13-17(24-9-11-26-12-10-24)15-3-1-2-4-16(15)21/h1-6,17H,7-13H2,(H2,22,23,25) |
| InChIKey | GBFJPZIUMNBDIU-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.84 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |