C17H18BrClN2O2S — CID 39588961
5-bromo-N-[(2R)-2-(2-chlorophenyl)-2-morpholin-4-ylethyl]thiophene-2-carboxamide (PubChem CID 39588961) has the molecular formula C17H18BrClN2O2S and a molecular weight of 429.77 g/mol. Its IUPAC name is 5-bromo-N-[(2R)-2-(2-chlorophenyl)-2-morpholin-4-ylethyl]thiophene-2-carboxamide.
| Compound Name | 5-bromo-N-[(2R)-2-(2-chlorophenyl)-2-morpholin-4-ylethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 39588961 |
| Molecular Formula | C17H18BrClN2O2S |
| Molecular Weight | 429.77 g/mol |
| Exact Mass | 428.00 |
| IUPAC Name | 5-bromo-N-[(2R)-2-(2-chlorophenyl)-2-morpholin-4-ylethyl]thiophene-2-carboxamide |
| SMILES | O=C(NC[C@@H](c1ccccc1Cl)N1CCOCC1)c1ccc(Br)s1 |
| InChI | InChI=1S/C17H18BrClN2O2S/c18-16-6-5-15(24-16)17(22)20-11-14(21-7-9-23-10-8-21)12-3-1-2-4-13(12)19/h1-6,14H,7-11H2,(H,20,22)/t14-/m0/s1 |
| InChIKey | AAVQZEYUPGZWKN-AWEZNQCLSA-N |
| XLogP | 3.97 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.77 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |