C14H22ClN3O3S — CID 110633437
2-(2-chlorophenyl)-N-(ethylsulfamoyl)-2-morpholin-4-ylethanamine (PubChem CID 110633437) has the molecular formula C14H22ClN3O3S and a molecular weight of 347.87 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-N-(ethylsulfamoyl)-2-morpholin-4-ylethanamine.
| Compound Name | 2-(2-chlorophenyl)-N-(ethylsulfamoyl)-2-morpholin-4-ylethanamine |
|---|---|
| PubChem CID | 110633437 |
| Molecular Formula | C14H22ClN3O3S |
| Molecular Weight | 347.87 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | 2-(2-chlorophenyl)-N-(ethylsulfamoyl)-2-morpholin-4-ylethanamine |
| SMILES | CCNS(=O)(=O)NCC(c1ccccc1Cl)N1CCOCC1 |
| InChI | InChI=1S/C14H22ClN3O3S/c1-2-16-22(19,20)17-11-14(18-7-9-21-10-8-18)12-5-3-4-6-13(12)15/h3-6,14,16-17H,2,7-11H2,1H3 |
| InChIKey | SRXQNXHUDUDLMW-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.87 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |