C14H17BrN2O3S3 — CID 124759272
5-bromo-N-[(2S)-2-(furan-2-yl)-2-thiomorpholin-4-ylethyl]thiophene-2-sulfonamide (PubChem CID 124759272) has the molecular formula C14H17BrN2O3S3 and a molecular weight of 437.41 g/mol. Its IUPAC name is 5-bromo-N-[(2S)-2-(furan-2-yl)-2-thiomorpholin-4-ylethyl]thiophene-2-sulfonamide.
| Compound Name | 5-bromo-N-[(2S)-2-(furan-2-yl)-2-thiomorpholin-4-ylethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 124759272 |
| Molecular Formula | C14H17BrN2O3S3 |
| Molecular Weight | 437.41 g/mol |
| Exact Mass | 435.96 |
| IUPAC Name | 5-bromo-N-[(2S)-2-(furan-2-yl)-2-thiomorpholin-4-ylethyl]thiophene-2-sulfonamide |
| SMILES | O=S(=O)(NC[C@@H](c1ccco1)N1CCSCC1)c1ccc(Br)s1 |
| InChI | InChI=1S/C14H17BrN2O3S3/c15-13-3-4-14(22-13)23(18,19)16-10-11(12-2-1-7-20-12)17-5-8-21-9-6-17/h1-4,7,11,16H,5-6,8-10H2/t11-/m0/s1 |
| InChIKey | CJQWHMIFTMRHQZ-NSHDSACASA-N |
| XLogP | 3.17 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.41 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |