C14H20N4O3S2 — CID 124877821
N-[(2S)-2-(furan-2-yl)-2-thiomorpholin-4-ylethyl]-1-methylpyrazole-4-sulfonamide (PubChem CID 124877821) has the molecular formula C14H20N4O3S2 and a molecular weight of 356.47 g/mol. Its IUPAC name is N-[(2S)-2-(furan-2-yl)-2-thiomorpholin-4-ylethyl]-1-methylpyrazole-4-sulfonamide.
| Compound Name | N-[(2S)-2-(furan-2-yl)-2-thiomorpholin-4-ylethyl]-1-methylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 124877821 |
| Molecular Formula | C14H20N4O3S2 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | N-[(2S)-2-(furan-2-yl)-2-thiomorpholin-4-ylethyl]-1-methylpyrazole-4-sulfonamide |
| SMILES | Cn1cc(S(=O)(=O)NC[C@@H](c2ccco2)N2CCSCC2)cn1 |
| InChI | InChI=1S/C14H20N4O3S2/c1-17-11-12(9-15-17)23(19,20)16-10-13(14-3-2-6-21-14)18-4-7-22-8-5-18/h2-3,6,9,11,13,16H,4-5,7-8,10H2,1H3/t13-/m0/s1 |
| InChIKey | VFXNHWCZBBTDHG-ZDUSSCGKSA-N |
| XLogP | 1.08 |
| TPSA | 80.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |