C17H22ClN3O3S — CID 110302582
6-chloro-N-[2-(furan-2-yl)-2-(4-methylpiperidin-1-yl)ethyl]pyridine-3-sulfonamide (PubChem CID 110302582) has the molecular formula C17H22ClN3O3S and a molecular weight of 383.90 g/mol. Its IUPAC name is 6-chloro-N-[2-(furan-2-yl)-2-(4-methylpiperidin-1-yl)ethyl]pyridine-3-sulfonamide.
| Compound Name | 6-chloro-N-[2-(furan-2-yl)-2-(4-methylpiperidin-1-yl)ethyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 110302582 |
| Molecular Formula | C17H22ClN3O3S |
| Molecular Weight | 383.90 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | 6-chloro-N-[2-(furan-2-yl)-2-(4-methylpiperidin-1-yl)ethyl]pyridine-3-sulfonamide |
| SMILES | CC1CCN(C(CNS(=O)(=O)c2ccc(Cl)nc2)c2ccco2)CC1 |
| InChI | InChI=1S/C17H22ClN3O3S/c1-13-6-8-21(9-7-13)15(16-3-2-10-24-16)12-20-25(22,23)14-4-5-17(18)19-11-14/h2-5,10-11,13,15,20H,6-9,12H2,1H3 |
| InChIKey | GNLBLPKUSAEPEY-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.90 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|