C21H34Cl2FN3O2 — CID 119865999
N-[2-(3-fluorophenyl)-2-morpholin-4-ylethyl]-3-piperidin-4-ylbutanamide;dihydrochloride (PubChem CID 119865999) has the molecular formula C21H34Cl2FN3O2 and a molecular weight of 450.43 g/mol. Its IUPAC name is N-[2-(3-fluorophenyl)-2-morpholin-4-ylethyl]-3-piperidin-4-ylbutanamide;dihydrochloride.
| Compound Name | N-[2-(3-fluorophenyl)-2-morpholin-4-ylethyl]-3-piperidin-4-ylbutanamide;dihydrochloride |
|---|---|
| PubChem CID | 119865999 |
| Molecular Formula | C21H34Cl2FN3O2 |
| Molecular Weight | 450.43 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | N-[2-(3-fluorophenyl)-2-morpholin-4-ylethyl]-3-piperidin-4-ylbutanamide;dihydrochloride |
| SMILES | CC(CC(=O)NCC(c1cccc(F)c1)N1CCOCC1)C1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C21H32FN3O2.2ClH/c1-16(17-5-7-23-8-6-17)13-21(26)24-15-20(25-9-11-27-12-10-25)18-3-2-4-19(22)14-18;;/h2-4,14,16-17,20,23H,5-13,15H2,1H3,(H,24,26);2*1H |
| InChIKey | GYXWFRSTVKWHTB-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.43 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |