C17H26FN3O3 — CID 120596042
4-amino-N-[2-(3-fluorophenyl)-2-morpholin-4-ylethyl]-3-methoxybutanamide (PubChem CID 120596042) has the molecular formula C17H26FN3O3 and a molecular weight of 339.41 g/mol. Its IUPAC name is 4-amino-N-[2-(3-fluorophenyl)-2-morpholin-4-ylethyl]-3-methoxybutanamide.
| Compound Name | 4-amino-N-[2-(3-fluorophenyl)-2-morpholin-4-ylethyl]-3-methoxybutanamide |
|---|---|
| PubChem CID | 120596042 |
| Molecular Formula | C17H26FN3O3 |
| Molecular Weight | 339.41 g/mol |
| Exact Mass | 339.20 |
| IUPAC Name | 4-amino-N-[2-(3-fluorophenyl)-2-morpholin-4-ylethyl]-3-methoxybutanamide |
| SMILES | COC(CN)CC(=O)NCC(c1cccc(F)c1)N1CCOCC1 |
| InChI | InChI=1S/C17H26FN3O3/c1-23-15(11-19)10-17(22)20-12-16(21-5-7-24-8-6-21)13-3-2-4-14(18)9-13/h2-4,9,15-16H,5-8,10-12,19H2,1H3,(H,20,22) |
| InChIKey | UWHFPJFOLVJEEW-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.41 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |