C13H16FNO3 — CID 116860419
methyl 2-(3-fluorophenyl)-2-morpholin-4-ylacetate (PubChem CID 116860419) has the molecular formula C13H16FNO3 and a molecular weight of 253.27 g/mol. Its IUPAC name is methyl 2-(3-fluorophenyl)-2-morpholin-4-ylacetate.
| Compound Name | methyl 2-(3-fluorophenyl)-2-morpholin-4-ylacetate |
|---|---|
| PubChem CID | 116860419 |
| Molecular Formula | C13H16FNO3 |
| Molecular Weight | 253.27 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | methyl 2-(3-fluorophenyl)-2-morpholin-4-ylacetate |
| SMILES | COC(=O)C(c1cccc(F)c1)N1CCOCC1 |
| InChI | InChI=1S/C13H16FNO3/c1-17-13(16)12(15-5-7-18-8-6-15)10-3-2-4-11(14)9-10/h2-4,9,12H,5-8H2,1H3 |
| InChIKey | IYXGJYXETAVNAW-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.27 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |