C16H20FN3O2 — CID 71998621
N-(2-cyanopropyl)-2-(3-fluorophenyl)-2-morpholin-4-ylacetamide (PubChem CID 71998621) has the molecular formula C16H20FN3O2 and a molecular weight of 305.35 g/mol. Its IUPAC name is N-(2-cyanopropyl)-2-(3-fluorophenyl)-2-morpholin-4-ylacetamide.
| Compound Name | N-(2-cyanopropyl)-2-(3-fluorophenyl)-2-morpholin-4-ylacetamide |
|---|---|
| PubChem CID | 71998621 |
| Molecular Formula | C16H20FN3O2 |
| Molecular Weight | 305.35 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | N-(2-cyanopropyl)-2-(3-fluorophenyl)-2-morpholin-4-ylacetamide |
| SMILES | CC(C#N)CNC(=O)C(c1cccc(F)c1)N1CCOCC1 |
| InChI | InChI=1S/C16H20FN3O2/c1-12(10-18)11-19-16(21)15(20-5-7-22-8-6-20)13-3-2-4-14(17)9-13/h2-4,9,12,15H,5-8,11H2,1H3,(H,19,21) |
| InChIKey | HPYKZKCMRTVLMW-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.35 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |