C17H24FN3O3 — CID 120947167
2-(3-fluorophenyl)-N-[(4-hydroxypyrrolidin-3-yl)methyl]-2-morpholin-4-ylacetamide (PubChem CID 120947167) has the molecular formula C17H24FN3O3 and a molecular weight of 337.40 g/mol. Its IUPAC name is 2-(3-fluorophenyl)-N-[(4-hydroxypyrrolidin-3-yl)methyl]-2-morpholin-4-ylacetamide.
| Compound Name | 2-(3-fluorophenyl)-N-[(4-hydroxypyrrolidin-3-yl)methyl]-2-morpholin-4-ylacetamide |
|---|---|
| PubChem CID | 120947167 |
| Molecular Formula | C17H24FN3O3 |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | 2-(3-fluorophenyl)-N-[(4-hydroxypyrrolidin-3-yl)methyl]-2-morpholin-4-ylacetamide |
| SMILES | O=C(NCC1CNCC1O)C(c1cccc(F)c1)N1CCOCC1 |
| InChI | InChI=1S/C17H24FN3O3/c18-14-3-1-2-12(8-14)16(21-4-6-24-7-5-21)17(23)20-10-13-9-19-11-15(13)22/h1-3,8,13,15-16,19,22H,4-7,9-11H2,(H,20,23) |
| InChIKey | SNYMYXUMWKYLJB-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |