C20H23FN4O3 — CID 97077185
(2S)-N-[4-[(carbamoylamino)methyl]phenyl]-2-(3-fluorophenyl)-2-morpholin-4-ylacetamide (PubChem CID 97077185) has the molecular formula C20H23FN4O3 and a molecular weight of 386.43 g/mol. Its IUPAC name is (2S)-N-[4-[(carbamoylamino)methyl]phenyl]-2-(3-fluorophenyl)-2-morpholin-4-ylacetamide.
| Compound Name | (2S)-N-[4-[(carbamoylamino)methyl]phenyl]-2-(3-fluorophenyl)-2-morpholin-4-ylacetamide |
|---|---|
| PubChem CID | 97077185 |
| Molecular Formula | C20H23FN4O3 |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | (2S)-N-[4-[(carbamoylamino)methyl]phenyl]-2-(3-fluorophenyl)-2-morpholin-4-ylacetamide |
| SMILES | NC(=O)NCc1ccc(NC(=O)[C@H](c2cccc(F)c2)N2CCOCC2)cc1 |
| InChI | InChI=1S/C20H23FN4O3/c21-16-3-1-2-15(12-16)18(25-8-10-28-11-9-25)19(26)24-17-6-4-14(5-7-17)13-23-20(22)27/h1-7,12,18H,8-11,13H2,(H,24,26)(H3,22,23,27)/t18-/m0/s1 |
| InChIKey | LMRUULVTNASVKH-SFHVURJKSA-N |
| XLogP | 2.01 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |