C19H24FIN4O — CID 110916922
2-[2-(3-fluorophenyl)-2-morpholin-4-ylethyl]-1-phenylguanidine;hydroiodide (PubChem CID 110916922) has the molecular formula C19H24FIN4O and a molecular weight of 470.33 g/mol. Its IUPAC name is 2-[2-(3-fluorophenyl)-2-morpholin-4-ylethyl]-1-phenylguanidine;hydroiodide.
| Compound Name | 2-[2-(3-fluorophenyl)-2-morpholin-4-ylethyl]-1-phenylguanidine;hydroiodide |
|---|---|
| PubChem CID | 110916922 |
| Molecular Formula | C19H24FIN4O |
| Molecular Weight | 470.33 g/mol |
| Exact Mass | 470.10 |
| IUPAC Name | 2-[2-(3-fluorophenyl)-2-morpholin-4-ylethyl]-1-phenylguanidine;hydroiodide |
| SMILES | I.N/C(=N\CC(c1cccc(F)c1)N1CCOCC1)Nc1ccccc1 |
| InChI | InChI=1S/C19H23FN4O.HI/c20-16-6-4-5-15(13-16)18(24-9-11-25-12-10-24)14-22-19(21)23-17-7-2-1-3-8-17;/h1-8,13,18H,9-12,14H2,(H3,21,22,23);1H |
| InChIKey | PLNAQUWDISBZPN-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 62.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.33 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|