C19H25FN4OS — CID 111085609
2-[2-(3-fluorophenyl)-2-morpholin-4-ylethyl]-1-(2-thiophen-2-ylethyl)guanidine (PubChem CID 111085609) has the molecular formula C19H25FN4OS and a molecular weight of 376.50 g/mol. Its IUPAC name is 2-[2-(3-fluorophenyl)-2-morpholin-4-ylethyl]-1-(2-thiophen-2-ylethyl)guanidine.
| Compound Name | 2-[2-(3-fluorophenyl)-2-morpholin-4-ylethyl]-1-(2-thiophen-2-ylethyl)guanidine |
|---|---|
| PubChem CID | 111085609 |
| Molecular Formula | C19H25FN4OS |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | 2-[2-(3-fluorophenyl)-2-morpholin-4-ylethyl]-1-(2-thiophen-2-ylethyl)guanidine |
| SMILES | N/C(=N\CC(c1cccc(F)c1)N1CCOCC1)NCCc1cccs1 |
| InChI | InChI=1S/C19H25FN4OS/c20-16-4-1-3-15(13-16)18(24-8-10-25-11-9-24)14-23-19(21)22-7-6-17-5-2-12-26-17/h1-5,12-13,18H,6-11,14H2,(H3,21,22,23) |
| InChIKey | LZDUSDVZWJSHPH-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 62.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|