C20H28N4OS — CID 111054825
2-[2-(3-methylphenyl)-2-morpholin-4-ylethyl]-1-(2-thiophen-2-ylethyl)guanidine (PubChem CID 111054825) has the molecular formula C20H28N4OS and a molecular weight of 372.54 g/mol. Its IUPAC name is 2-[2-(3-methylphenyl)-2-morpholin-4-ylethyl]-1-(2-thiophen-2-ylethyl)guanidine.
| Compound Name | 2-[2-(3-methylphenyl)-2-morpholin-4-ylethyl]-1-(2-thiophen-2-ylethyl)guanidine |
|---|---|
| PubChem CID | 111054825 |
| Molecular Formula | C20H28N4OS |
| Molecular Weight | 372.54 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | 2-[2-(3-methylphenyl)-2-morpholin-4-ylethyl]-1-(2-thiophen-2-ylethyl)guanidine |
| SMILES | Cc1cccc(C(C/N=C(\N)NCCc2cccs2)N2CCOCC2)c1 |
| InChI | InChI=1S/C20H28N4OS/c1-16-4-2-5-17(14-16)19(24-9-11-25-12-10-24)15-23-20(21)22-8-7-18-6-3-13-26-18/h2-6,13-14,19H,7-12,15H2,1H3,(H3,21,22,23) |
| InChIKey | PXCKJLGRUYJIBF-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 62.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.54 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|