C19H29FN2O — CID 119796132
N-[2-(3-fluorophenyl)-2-methylpropyl]-3-piperidin-4-ylbutanamide (PubChem CID 119796132) has the molecular formula C19H29FN2O and a molecular weight of 320.45 g/mol. Its IUPAC name is N-[2-(3-fluorophenyl)-2-methylpropyl]-3-piperidin-4-ylbutanamide.
| Compound Name | N-[2-(3-fluorophenyl)-2-methylpropyl]-3-piperidin-4-ylbutanamide |
|---|---|
| PubChem CID | 119796132 |
| Molecular Formula | C19H29FN2O |
| Molecular Weight | 320.45 g/mol |
| Exact Mass | 320.23 |
| IUPAC Name | N-[2-(3-fluorophenyl)-2-methylpropyl]-3-piperidin-4-ylbutanamide |
| SMILES | CC(CC(=O)NCC(C)(C)c1cccc(F)c1)C1CCNCC1 |
| InChI | InChI=1S/C19H29FN2O/c1-14(15-7-9-21-10-8-15)11-18(23)22-13-19(2,3)16-5-4-6-17(20)12-16/h4-6,12,14-15,21H,7-11,13H2,1-3H3,(H,22,23) |
| InChIKey | DBUGZNAKWRSKHK-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.45 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |