C11H19F3N2O — CID 119726417
3-piperidin-4-yl-N-(2,2,2-trifluoroethyl)butanamide (PubChem CID 119726417) has the molecular formula C11H19F3N2O and a molecular weight of 252.28 g/mol. Its IUPAC name is 3-piperidin-4-yl-N-(2,2,2-trifluoroethyl)butanamide.
| Compound Name | 3-piperidin-4-yl-N-(2,2,2-trifluoroethyl)butanamide |
|---|---|
| PubChem CID | 119726417 |
| Molecular Formula | C11H19F3N2O |
| Molecular Weight | 252.28 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | 3-piperidin-4-yl-N-(2,2,2-trifluoroethyl)butanamide |
| SMILES | CC(CC(=O)NCC(F)(F)F)C1CCNCC1 |
| InChI | InChI=1S/C11H19F3N2O/c1-8(9-2-4-15-5-3-9)6-10(17)16-7-11(12,13)14/h8-9,15H,2-7H2,1H3,(H,16,17) |
| InChIKey | STROFSULAQKUSI-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.28 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |