C14H20N4O2S — CID 97078921
(4S)-2-oxo-N-[(2S)-2-pyrrolidin-1-yl-2-thiophen-2-ylethyl]imidazolidine-4-carboxamide (PubChem CID 97078921) has the molecular formula C14H20N4O2S and a molecular weight of 308.41 g/mol. Its IUPAC name is (4S)-2-oxo-N-[(2S)-2-pyrrolidin-1-yl-2-thiophen-2-ylethyl]imidazolidine-4-carboxamide.
| Compound Name | (4S)-2-oxo-N-[(2S)-2-pyrrolidin-1-yl-2-thiophen-2-ylethyl]imidazolidine-4-carboxamide |
|---|---|
| PubChem CID | 97078921 |
| Molecular Formula | C14H20N4O2S |
| Molecular Weight | 308.41 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | (4S)-2-oxo-N-[(2S)-2-pyrrolidin-1-yl-2-thiophen-2-ylethyl]imidazolidine-4-carboxamide |
| SMILES | O=C1NC[C@@H](C(=O)NC[C@@H](c2cccs2)N2CCCC2)N1 |
| InChI | InChI=1S/C14H20N4O2S/c19-13(10-8-16-14(20)17-10)15-9-11(12-4-3-7-21-12)18-5-1-2-6-18/h3-4,7,10-11H,1-2,5-6,8-9H2,(H,15,19)(H2,16,17,20)/t10-,11-/m0/s1 |
| InChIKey | GBRWGPZFYYQMNL-QWRGUYRKSA-N |
| XLogP | 0.68 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.41 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |