C22H31N7O — CID 111207894
N'-methyl-N-(2-morpholin-4-yl-2-phenylethyl)-4-pyrimidin-2-ylpiperazine-1-carboximidamide (PubChem CID 111207894) has the molecular formula C22H31N7O and a molecular weight of 409.54 g/mol. Its IUPAC name is N'-methyl-N-(2-morpholin-4-yl-2-phenylethyl)-4-pyrimidin-2-ylpiperazine-1-carboximidamide.
| Compound Name | N'-methyl-N-(2-morpholin-4-yl-2-phenylethyl)-4-pyrimidin-2-ylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111207894 |
| Molecular Formula | C22H31N7O |
| Molecular Weight | 409.54 g/mol |
| Exact Mass | 409.26 |
| IUPAC Name | N'-methyl-N-(2-morpholin-4-yl-2-phenylethyl)-4-pyrimidin-2-ylpiperazine-1-carboximidamide |
| SMILES | C/N=C(\NCC(c1ccccc1)N1CCOCC1)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C22H31N7O/c1-23-21(28-10-12-29(13-11-28)22-24-8-5-9-25-22)26-18-20(19-6-3-2-4-7-19)27-14-16-30-17-15-27/h2-9,20H,10-18H2,1H3,(H,23,26) |
| InChIKey | OOQKEDYOCOUBCF-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 69.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.54 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|