C20H21FN4O2S — CID 55650784
1-(2-fluorophenyl)-N-(2-morpholin-4-yl-2-thiophen-2-ylethyl)pyrazole-3-carboxamide (PubChem CID 55650784) has the molecular formula C20H21FN4O2S and a molecular weight of 400.48 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-N-(2-morpholin-4-yl-2-thiophen-2-ylethyl)pyrazole-3-carboxamide.
| Compound Name | 1-(2-fluorophenyl)-N-(2-morpholin-4-yl-2-thiophen-2-ylethyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 55650784 |
| Molecular Formula | C20H21FN4O2S |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | 1-(2-fluorophenyl)-N-(2-morpholin-4-yl-2-thiophen-2-ylethyl)pyrazole-3-carboxamide |
| SMILES | O=C(NCC(c1cccs1)N1CCOCC1)c1ccn(-c2ccccc2F)n1 |
| InChI | InChI=1S/C20H21FN4O2S/c21-15-4-1-2-5-17(15)25-8-7-16(23-25)20(26)22-14-18(19-6-3-13-28-19)24-9-11-27-12-10-24/h1-8,13,18H,9-12,14H2,(H,22,26) |
| InChIKey | UXEZKXPSIPEARE-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |