C18H20N6O2S — CID 51931032
N-[(2S)-2-morpholin-4-yl-2-thiophen-2-ylethyl]-2-(tetrazol-1-yl)benzamide (PubChem CID 51931032) has the molecular formula C18H20N6O2S and a molecular weight of 384.47 g/mol. Its IUPAC name is N-[(2S)-2-morpholin-4-yl-2-thiophen-2-ylethyl]-2-(tetrazol-1-yl)benzamide.
| Compound Name | N-[(2S)-2-morpholin-4-yl-2-thiophen-2-ylethyl]-2-(tetrazol-1-yl)benzamide |
|---|---|
| PubChem CID | 51931032 |
| Molecular Formula | C18H20N6O2S |
| Molecular Weight | 384.47 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | N-[(2S)-2-morpholin-4-yl-2-thiophen-2-ylethyl]-2-(tetrazol-1-yl)benzamide |
| SMILES | O=C(NC[C@@H](c1cccs1)N1CCOCC1)c1ccccc1-n1cnnn1 |
| InChI | InChI=1S/C18H20N6O2S/c25-18(14-4-1-2-5-15(14)24-13-20-21-22-24)19-12-16(17-6-3-11-27-17)23-7-9-26-10-8-23/h1-6,11,13,16H,7-10,12H2,(H,19,25)/t16-/m0/s1 |
| InChIKey | SGDJJDYHMTWRSP-INIZCTEOSA-N |
| XLogP | 1.53 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.47 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |