C23H31FIN5O3 — CID 111167120
N-[2-(3-fluorophenyl)-2-morpholin-4-ylethyl]-4-(furan-2-carbonyl)-N'-methylpiperazine-1-carboximidamide;hydroiodide (PubChem CID 111167120) has the molecular formula C23H31FIN5O3 and a molecular weight of 571.44 g/mol. Its IUPAC name is N-[2-(3-fluorophenyl)-2-morpholin-4-ylethyl]-4-(furan-2-carbonyl)-N'-methylpiperazine-1-carboximidamide;hydroiodide.
| Compound Name | N-[2-(3-fluorophenyl)-2-morpholin-4-ylethyl]-4-(furan-2-carbonyl)-N'-methylpiperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111167120 |
| Molecular Formula | C23H31FIN5O3 |
| Molecular Weight | 571.44 g/mol |
| Exact Mass | 571.15 |
| IUPAC Name | N-[2-(3-fluorophenyl)-2-morpholin-4-ylethyl]-4-(furan-2-carbonyl)-N'-methylpiperazine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCC(c1cccc(F)c1)N1CCOCC1)N1CCN(C(=O)c2ccco2)CC1.I |
| InChI | InChI=1S/C23H30FN5O3.HI/c1-25-23(29-9-7-28(8-10-29)22(30)21-6-3-13-32-21)26-17-20(27-11-14-31-15-12-27)18-4-2-5-19(24)16-18;/h2-6,13,16,20H,7-12,14-15,17H2,1H3,(H,25,26);1H |
| InChIKey | HGWHJGDLWULSDC-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 73.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.44 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|