C23H39N5O2 — CID 109447995
N'-[(1-cyclopentylpyrazol-3-yl)methyl]-N-ethyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide (PubChem CID 109447995) has the molecular formula C23H39N5O2 and a molecular weight of 417.60 g/mol. Its IUPAC name is N'-[(1-cyclopentylpyrazol-3-yl)methyl]-N-ethyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide.
| Compound Name | N'-[(1-cyclopentylpyrazol-3-yl)methyl]-N-ethyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 109447995 |
| Molecular Formula | C23H39N5O2 |
| Molecular Weight | 417.60 g/mol |
| Exact Mass | 417.31 |
| IUPAC Name | N'-[(1-cyclopentylpyrazol-3-yl)methyl]-N-ethyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide |
| SMILES | CCN/C(=N\Cc1ccn(C2CCCC2)n1)N1CCC(OCC2CCCCO2)CC1 |
| InChI | InChI=1S/C23H39N5O2/c1-2-24-23(25-17-19-10-15-28(26-19)20-7-3-4-8-20)27-13-11-21(12-14-27)30-18-22-9-5-6-16-29-22/h10,15,20-22H,2-9,11-14,16-18H2,1H3,(H,24,25) |
| InChIKey | FXCFNYUTHGLESO-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 63.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.60 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|