C21H35N3O3 — CID 110057330
N'-butyl-N-[2-(furan-2-yl)ethyl]-4-(oxolan-2-ylmethoxy)piperidine-1-carboximidamide (PubChem CID 110057330) has the molecular formula C21H35N3O3 and a molecular weight of 377.53 g/mol. Its IUPAC name is N'-butyl-N-[2-(furan-2-yl)ethyl]-4-(oxolan-2-ylmethoxy)piperidine-1-carboximidamide.
| Compound Name | N'-butyl-N-[2-(furan-2-yl)ethyl]-4-(oxolan-2-ylmethoxy)piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 110057330 |
| Molecular Formula | C21H35N3O3 |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.27 |
| IUPAC Name | N'-butyl-N-[2-(furan-2-yl)ethyl]-4-(oxolan-2-ylmethoxy)piperidine-1-carboximidamide |
| SMILES | CCCC/N=C(\NCCc1ccco1)N1CCC(OCC2CCCO2)CC1 |
| InChI | InChI=1S/C21H35N3O3/c1-2-3-11-22-21(23-12-8-18-6-4-15-25-18)24-13-9-19(10-14-24)27-17-20-7-5-16-26-20/h4,6,15,19-20H,2-3,5,7-14,16-17H2,1H3,(H,22,23) |
| InChIKey | OBJWMLFPDIMEII-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 59.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|