C25H42N4O3 — CID 110057410
4-(cyclopentylmethoxy)-N-[2-(furan-2-yl)ethyl]-N'-(3-morpholin-4-ylpropyl)piperidine-1-carboximidamide (PubChem CID 110057410) has the molecular formula C25H42N4O3 and a molecular weight of 446.64 g/mol. Its IUPAC name is 4-(cyclopentylmethoxy)-N-[2-(furan-2-yl)ethyl]-N'-(3-morpholin-4-ylpropyl)piperidine-1-carboximidamide.
| Compound Name | 4-(cyclopentylmethoxy)-N-[2-(furan-2-yl)ethyl]-N'-(3-morpholin-4-ylpropyl)piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 110057410 |
| Molecular Formula | C25H42N4O3 |
| Molecular Weight | 446.64 g/mol |
| Exact Mass | 446.33 |
| IUPAC Name | 4-(cyclopentylmethoxy)-N-[2-(furan-2-yl)ethyl]-N'-(3-morpholin-4-ylpropyl)piperidine-1-carboximidamide |
| SMILES | c1coc(CCN/C(=N\CCCN2CCOCC2)N2CCC(OCC3CCCC3)CC2)c1 |
| InChI | InChI=1S/C25H42N4O3/c1-2-6-22(5-1)21-32-24-9-14-29(15-10-24)25(27-12-8-23-7-3-18-31-23)26-11-4-13-28-16-19-30-20-17-28/h3,7,18,22,24H,1-2,4-6,8-17,19-21H2,(H,26,27) |
| InChIKey | GKNQKBSFMAEZME-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.64 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|