C23H39N5O3 — CID 110056334
N-[2-(furan-2-yl)ethyl]-3-(morpholin-4-ylmethyl)-N'-(3-morpholin-4-ylpropyl)pyrrolidine-1-carboximidamide (PubChem CID 110056334) has the molecular formula C23H39N5O3 and a molecular weight of 433.60 g/mol. Its IUPAC name is N-[2-(furan-2-yl)ethyl]-3-(morpholin-4-ylmethyl)-N'-(3-morpholin-4-ylpropyl)pyrrolidine-1-carboximidamide.
| Compound Name | N-[2-(furan-2-yl)ethyl]-3-(morpholin-4-ylmethyl)-N'-(3-morpholin-4-ylpropyl)pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 110056334 |
| Molecular Formula | C23H39N5O3 |
| Molecular Weight | 433.60 g/mol |
| Exact Mass | 433.31 |
| IUPAC Name | N-[2-(furan-2-yl)ethyl]-3-(morpholin-4-ylmethyl)-N'-(3-morpholin-4-ylpropyl)pyrrolidine-1-carboximidamide |
| SMILES | c1coc(CCN/C(=N\CCCN2CCOCC2)N2CCC(CN3CCOCC3)C2)c1 |
| InChI | InChI=1S/C23H39N5O3/c1-3-22(31-14-1)4-7-25-23(24-6-2-8-26-10-15-29-16-11-26)28-9-5-21(20-28)19-27-12-17-30-18-13-27/h1,3,14,21H,2,4-13,15-20H2,(H,24,25) |
| InChIKey | ANPMZPYJAIOFNV-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 65.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.60 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|