C21H35N5O4 — CID 111163869
ethyl 4-[N-[2-(furan-2-yl)ethyl]-N'-(3-morpholin-4-ylpropyl)carbamimidoyl]piperazine-1-carboxylate (PubChem CID 111163869) has the molecular formula C21H35N5O4 and a molecular weight of 421.54 g/mol. Its IUPAC name is ethyl 4-[N-[2-(furan-2-yl)ethyl]-N'-(3-morpholin-4-ylpropyl)carbamimidoyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[N-[2-(furan-2-yl)ethyl]-N'-(3-morpholin-4-ylpropyl)carbamimidoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 111163869 |
| Molecular Formula | C21H35N5O4 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.27 |
| IUPAC Name | ethyl 4-[N-[2-(furan-2-yl)ethyl]-N'-(3-morpholin-4-ylpropyl)carbamimidoyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(/C(=N/CCCN2CCOCC2)NCCc2ccco2)CC1 |
| InChI | InChI=1S/C21H35N5O4/c1-2-29-21(27)26-12-10-25(11-13-26)20(23-8-6-19-5-3-16-30-19)22-7-4-9-24-14-17-28-18-15-24/h3,5,16H,2,4,6-15,17-18H2,1H3,(H,22,23) |
| InChIKey | UCIXVAUFWGUEFB-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 82.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|