C23H34IN5O2 — CID 110053439
2-[[[4-(2,3-dimethylphenyl)piperazin-1-yl]-[2-(furan-2-yl)ethylamino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 110053439) has the molecular formula C23H34IN5O2 and a molecular weight of 539.46 g/mol. Its IUPAC name is 2-[[[4-(2,3-dimethylphenyl)piperazin-1-yl]-[2-(furan-2-yl)ethylamino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[[4-(2,3-dimethylphenyl)piperazin-1-yl]-[2-(furan-2-yl)ethylamino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 110053439 |
| Molecular Formula | C23H34IN5O2 |
| Molecular Weight | 539.46 g/mol |
| Exact Mass | 539.18 |
| IUPAC Name | 2-[[[4-(2,3-dimethylphenyl)piperazin-1-yl]-[2-(furan-2-yl)ethylamino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | Cc1cccc(N2CCN(/C(=N/CC(=O)N(C)C)NCCc3ccco3)CC2)c1C.I |
| InChI | InChI=1S/C23H33N5O2.HI/c1-18-7-5-9-21(19(18)2)27-12-14-28(15-13-27)23(25-17-22(29)26(3)4)24-11-10-20-8-6-16-30-20;/h5-9,16H,10-15,17H2,1-4H3,(H,24,25);1H |
| InChIKey | VGLDYQALLUEAEF-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 64.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.46 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|