C20H29F3IN5O2 — CID 110044464
2-[1-[N-[2-(dimethylamino)-2-oxoethyl]-N'-[[3-(trifluoromethyl)phenyl]methyl]carbamimidoyl]piperidin-3-yl]acetamide;hydroiodide (PubChem CID 110044464) has the molecular formula C20H29F3IN5O2 and a molecular weight of 555.38 g/mol. Its IUPAC name is 2-[1-[N-[2-(dimethylamino)-2-oxoethyl]-N'-[[3-(trifluoromethyl)phenyl]methyl]carbamimidoyl]piperidin-3-yl]acetamide;hydroiodide.
| Compound Name | 2-[1-[N-[2-(dimethylamino)-2-oxoethyl]-N'-[[3-(trifluoromethyl)phenyl]methyl]carbamimidoyl]piperidin-3-yl]acetamide;hydroiodide |
|---|---|
| PubChem CID | 110044464 |
| Molecular Formula | C20H29F3IN5O2 |
| Molecular Weight | 555.38 g/mol |
| Exact Mass | 555.13 |
| IUPAC Name | 2-[1-[N-[2-(dimethylamino)-2-oxoethyl]-N'-[[3-(trifluoromethyl)phenyl]methyl]carbamimidoyl]piperidin-3-yl]acetamide;hydroiodide |
| SMILES | CN(C)C(=O)CN/C(=N\Cc1cccc(C(F)(F)F)c1)N1CCCC(CC(N)=O)C1.I |
| InChI | InChI=1S/C20H28F3N5O2.HI/c1-27(2)18(30)12-26-19(28-8-4-6-15(13-28)10-17(24)29)25-11-14-5-3-7-16(9-14)20(21,22)23;/h3,5,7,9,15H,4,6,8,10-13H2,1-2H3,(H2,24,29)(H,25,26);1H |
| InChIKey | NPCVDBYFMOBWNU-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 91.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.38 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|