C21H33N5O2 — CID 110038915
2-[[N-(1-cyclopropylpiperidin-4-yl)-N'-[(4-methoxyphenyl)methyl]carbamimidoyl]amino]-N,N-dimethylacetamide (PubChem CID 110038915) has the molecular formula C21H33N5O2 and a molecular weight of 387.53 g/mol. Its IUPAC name is 2-[[N-(1-cyclopropylpiperidin-4-yl)-N'-[(4-methoxyphenyl)methyl]carbamimidoyl]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[N-(1-cyclopropylpiperidin-4-yl)-N'-[(4-methoxyphenyl)methyl]carbamimidoyl]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 110038915 |
| Molecular Formula | C21H33N5O2 |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 387.26 |
| IUPAC Name | 2-[[N-(1-cyclopropylpiperidin-4-yl)-N'-[(4-methoxyphenyl)methyl]carbamimidoyl]amino]-N,N-dimethylacetamide |
| SMILES | COc1ccc(C/N=C(\NCC(=O)N(C)C)NC2CCN(C3CC3)CC2)cc1 |
| InChI | InChI=1S/C21H33N5O2/c1-25(2)20(27)15-23-21(22-14-16-4-8-19(28-3)9-5-16)24-17-10-12-26(13-11-17)18-6-7-18/h4-5,8-9,17-18H,6-7,10-15H2,1-3H3,(H2,22,23,24) |
| InChIKey | NRQXUSJGSDZOOF-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|