C22H35N5O4 — CID 110048288
2-[[N'-[(4-methoxyphenyl)methyl]-N-[1-(3-methoxypropanoyl)piperidin-4-yl]carbamimidoyl]amino]-N,N-dimethylacetamide (PubChem CID 110048288) has the molecular formula C22H35N5O4 and a molecular weight of 433.55 g/mol. Its IUPAC name is 2-[[N'-[(4-methoxyphenyl)methyl]-N-[1-(3-methoxypropanoyl)piperidin-4-yl]carbamimidoyl]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[N'-[(4-methoxyphenyl)methyl]-N-[1-(3-methoxypropanoyl)piperidin-4-yl]carbamimidoyl]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 110048288 |
| Molecular Formula | C22H35N5O4 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.27 |
| IUPAC Name | 2-[[N'-[(4-methoxyphenyl)methyl]-N-[1-(3-methoxypropanoyl)piperidin-4-yl]carbamimidoyl]amino]-N,N-dimethylacetamide |
| SMILES | COCCC(=O)N1CCC(N/C(=N/Cc2ccc(OC)cc2)NCC(=O)N(C)C)CC1 |
| InChI | InChI=1S/C22H35N5O4/c1-26(2)21(29)16-24-22(23-15-17-5-7-19(31-4)8-6-17)25-18-9-12-27(13-10-18)20(28)11-14-30-3/h5-8,18H,9-16H2,1-4H3,(H2,23,24,25) |
| InChIKey | NNBYAGNCCAWUDN-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|